C16H16Cl2N2O4 — CID 171855676
benzyl N-[3-(2,4-dichloro-3-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855676) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is benzyl N-[3-(2,4-dichloro-3-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2,4-dichloro-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855676 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | benzyl N-[3-(2,4-dichloro-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1c(Cl)ccnc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2O4/c17-11-6-7-19-15(18)13(11)14(22)12(21)8-20-16(23)24-9-10-4-2-1-3-5-10/h1-7,12,14,21-22H,8-9H2,(H,20,23) |
| InChIKey | UDSUFDBEMUATRZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|