C17H19ClN2O4 — CID 171855641
benzyl N-[3-(2-chloro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855641) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is benzyl N-[3-(2-chloro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2-chloro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855641 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | benzyl N-[3-(2-chloro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1cnc(Cl)c(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-11-7-13(16(18)19-8-11)15(22)14(21)9-20-17(23)24-10-12-5-3-2-4-6-12/h2-8,14-15,21-22H,9-10H2,1H3,(H,20,23) |
| InChIKey | XBBYIMOCYXKRLJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|