C22H21NO5 — CID 15313691
(1R)-1-[3,4-bis(phenylmethoxy)phenyl]-2-nitroethanol (PubChem CID 15313691) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is (1R)-1-[3,4-bis(phenylmethoxy)phenyl]-2-nitroethanol.
| Compound Name | (1R)-1-[3,4-bis(phenylmethoxy)phenyl]-2-nitroethanol |
|---|---|
| PubChem CID | 15313691 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (1R)-1-[3,4-bis(phenylmethoxy)phenyl]-2-nitroethanol |
| SMILES | O=[N+]([O-])C[C@H](O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO5/c24-20(14-23(25)26)19-11-12-21(27-15-17-7-3-1-4-8-17)22(13-19)28-16-18-9-5-2-6-10-18/h1-13,20,24H,14-16H2/t20-/m0/s1 |
| InChIKey | ZDTPGOFRVWSBGZ-FQEVSTJZSA-N |
| XLogP | 4.15 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|