C23H24O4 — CID 22338943
4-[bis(2-hydroxy-4,6-dimethylphenyl)methyl]benzene-1,2-diol (PubChem CID 22338943) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[bis(2-hydroxy-4,6-dimethylphenyl)methyl]benzene-1,2-diol.
| Compound Name | 4-[bis(2-hydroxy-4,6-dimethylphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 22338943 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[bis(2-hydroxy-4,6-dimethylphenyl)methyl]benzene-1,2-diol |
| SMILES | Cc1cc(C)c(C(c2ccc(O)c(O)c2)c2c(C)cc(C)cc2O)c(O)c1 |
| InChI | InChI=1S/C23H24O4/c1-12-7-14(3)21(19(26)9-12)23(16-5-6-17(24)18(25)11-16)22-15(4)8-13(2)10-20(22)27/h5-11,23-27H,1-4H3 |
| InChIKey | IGQQWLCZVPABHC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|