C22H20F2 — CID 102424992
2-[bis(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 102424992) has the molecular formula C22H20F2 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 102424992 |
| Molecular Formula | C22H20F2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(c2ccc(F)cc2)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C22H20F2/c1-14-12-15(2)21(16(3)13-14)22(17-4-8-19(23)9-5-17)18-6-10-20(24)11-7-18/h4-13,22H,1-3H3 |
| InChIKey | OSSDIKZYULDSGT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|