C21H19F2N — CID 166514655
4-[bis(4-fluorophenyl)methyl]-2,6-dimethylaniline (PubChem CID 166514655) has the molecular formula C21H19F2N and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-2,6-dimethylaniline.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 166514655 |
| Molecular Formula | C21H19F2N |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(C(c2ccc(F)cc2)c2ccc(F)cc2)cc(C)c1N |
| InChI | InChI=1S/C21H19F2N/c1-13-11-17(12-14(2)21(13)24)20(15-3-7-18(22)8-4-15)16-5-9-19(23)10-6-16/h3-12,20H,24H2,1-2H3 |
| InChIKey | NSXWQSTUECEOST-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|