About CID 136701578
CID 136701578 (PubChem CID 136701578) has the molecular formula C117H81F12Si
and a molecular weight of 1743.00 g/mol.
Molecular Properties
| Compound Name | CID 136701578 |
| PubChem CID | 136701578 |
| Molecular Formula | C117H81F12Si |
| Molecular Weight | 1743.00 g/mol |
| Exact Mass | 1741.59 |
| IUPAC Name | — |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)c2ccc(C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)[Si](C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C117H81F12Si/c118-97-49-25-79(26-50-97)109(80-27-51-98(119)52-28-80)73-1-13-91(14-2-73)115(92-15-3-74(4-16-92)110(81-29-53-99(120)54-30-81)82-31-55-100(121)56-32-82)130(116(93-17-5-75(6-18-93)111(83-33-57-101(122)58-34-83)84-35-59-102(123)60-36-84)94-19-7-76(8-20-94)112(85-37-61-103(124)62-38-85)86-39-63-104(125)64-40-86)117(95-21-9-77(10-22-95)113(87-41-65-105(126)66-42-87)88-43-67-106(127)68-44-88)96-23-11-78(12-24-96)114(89-45-69-107(128)70-46-89)90-47-71-108(129)72-48-90/h1-72,109-117H |
| InChIKey | AGWOHDGSDIHBQW-UHFFFAOYSA-N |
| XLogP | 30.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 130 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1743.00 |
| LogP ≤ 5 | 30.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 136701578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136701578?
The IUPAC name of CID 136701578 (CID 136701578) is not available.
What is the SMILES notation for CID 136701578?
The canonical SMILES for CID 136701578 is Fc1ccc(C(c2ccc(F)cc2)c2ccc(C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)[Si](C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)C(c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)c3ccc(C(c4ccc(F)cc4)c4ccc(F)cc4)cc3)cc2)cc1.
What is the InChIKey of CID 136701578?
The InChIKey is AGWOHDGSDIHBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C117H81F12Si/c118-97-49-25-79(26-50-97)109(80-27-51-98(119)52-28-80)73-1-13-91(14-2-73)115(92-15-3-74(4-16-92)110(81-29-53-99(120)54-30-81)82-31-55-100(121)56-32-82)130(116(93-17-5-75(6-18-93)111(83-33-57-101(122)58-34-83)84-35-59-102(123)60-36-84)94-19-7-76(8-20-94)112(85-37-61-103(124)62-38-85)86-39-63-104(125)64-40-86)117(95-21-9-77(10-22-95)113(87-41-65-105(126)66-42-87)88-43-67-106(127)68-44-88)96-23-11-78(12-24-96)114(89-45-69-107(128)70-46-89)90-47-71-108(129)72-48-90/h1-72,109-117H.
What are the key properties of CID 136701578?
CID 136701578 has a molecular weight of 1743.00 g/mol, XLogP of 30.35, 27 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136701578 is sourced from PubChem (CID 136701578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).