About 1-fluoro-4-propan-2-ylbenzene;2-methylpropane
1-fluoro-4-propan-2-ylbenzene;2-methylpropane (PubChem CID 177367696) has the molecular formula C13H21F
and a molecular weight of 196.31 g/mol. Its IUPAC name is 1-fluoro-4-propan-2-ylbenzene;2-methylpropane.
Molecular Properties
| Compound Name | 1-fluoro-4-propan-2-ylbenzene;2-methylpropane |
| PubChem CID | 177367696 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-fluoro-4-propan-2-ylbenzene;2-methylpropane |
| SMILES | CC(C)C.CC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H11F.C4H10/c1-7(2)8-3-5-9(10)6-4-8;1-4(2)3/h3-7H,1-2H3;4H,1-3H3 |
| InChIKey | ZYPLSNNGVCGIPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-propan-2-ylbenzene;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-propan-2-ylbenzene;2-methylpropane?
The IUPAC name of 1-fluoro-4-propan-2-ylbenzene;2-methylpropane (CID 177367696) is 1-fluoro-4-propan-2-ylbenzene;2-methylpropane.
What is the SMILES notation for 1-fluoro-4-propan-2-ylbenzene;2-methylpropane?
The canonical SMILES for 1-fluoro-4-propan-2-ylbenzene;2-methylpropane is CC(C)C.CC(C)c1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-propan-2-ylbenzene;2-methylpropane?
The InChIKey is ZYPLSNNGVCGIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F.C4H10/c1-7(2)8-3-5-9(10)6-4-8;1-4(2)3/h3-7H,1-2H3;4H,1-3H3.
What are the key properties of 1-fluoro-4-propan-2-ylbenzene;2-methylpropane?
1-fluoro-4-propan-2-ylbenzene;2-methylpropane has a molecular weight of 196.31 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-propan-2-ylbenzene;2-methylpropane is sourced from PubChem (CID 177367696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).