About deuterium monohydride;1-fluoro-4-propan-2-ylbenzene
deuterium monohydride;1-fluoro-4-propan-2-ylbenzene (PubChem CID 167565011) has the molecular formula C9H13F
and a molecular weight of 141.21 g/mol. Its IUPAC name is deuterium monohydride;1-fluoro-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | deuterium monohydride;1-fluoro-4-propan-2-ylbenzene |
| PubChem CID | 167565011 |
| Molecular Formula | C9H13F |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.11 |
| IUPAC Name | deuterium monohydride;1-fluoro-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(F)cc1.[H][2H] |
| InChI | InChI=1S/C9H11F.H2/c1-7(2)8-3-5-9(10)6-4-8;/h3-7H,1-2H3;1H/i;1+1 |
| InChIKey | FDVFVJWDSZLPOQ-IEOVAKBOSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze deuterium monohydride;1-fluoro-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;1-fluoro-4-propan-2-ylbenzene?
The IUPAC name of deuterium monohydride;1-fluoro-4-propan-2-ylbenzene (CID 167565011) is deuterium monohydride;1-fluoro-4-propan-2-ylbenzene.
What is the SMILES notation for deuterium monohydride;1-fluoro-4-propan-2-ylbenzene?
The canonical SMILES for deuterium monohydride;1-fluoro-4-propan-2-ylbenzene is CC(C)c1ccc(F)cc1.[H][2H].
What is the InChIKey of deuterium monohydride;1-fluoro-4-propan-2-ylbenzene?
The InChIKey is FDVFVJWDSZLPOQ-IEOVAKBOSA-N. The full InChI is InChI=1S/C9H11F.H2/c1-7(2)8-3-5-9(10)6-4-8;/h3-7H,1-2H3;1H/i;1+1.
What are the key properties of deuterium monohydride;1-fluoro-4-propan-2-ylbenzene?
deuterium monohydride;1-fluoro-4-propan-2-ylbenzene has a molecular weight of 141.21 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;1-fluoro-4-propan-2-ylbenzene is sourced from PubChem (CID 167565011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).