C24H25Cl2N — CID 147613699
4-[(2,6-dichlorophenyl)-(3,4,5-trimethylphenyl)methyl]-2,6-dimethylaniline (PubChem CID 147613699) has the molecular formula C24H25Cl2N and a molecular weight of 398.38 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)-(3,4,5-trimethylphenyl)methyl]-2,6-dimethylaniline.
| Compound Name | 4-[(2,6-dichlorophenyl)-(3,4,5-trimethylphenyl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 147613699 |
| Molecular Formula | C24H25Cl2N |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)-(3,4,5-trimethylphenyl)methyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(C(c2cc(C)c(N)c(C)c2)c2c(Cl)cccc2Cl)cc(C)c1C |
| InChI | InChI=1S/C24H25Cl2N/c1-13-9-18(10-14(2)17(13)5)22(23-20(25)7-6-8-21(23)26)19-11-15(3)24(27)16(4)12-19/h6-12,22H,27H2,1-5H3 |
| InChIKey | GCMOAUHMHLQSOM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|