C44H42O8 — CID 139962404
4-[[4-[bis(4-carboxy-3,5-dimethylphenyl)methyl]phenyl]-(4-carboxy-3,5-dimethylphenyl)methyl]-2,6-dimethylbenzoic acid (PubChem CID 139962404) has the molecular formula C44H42O8 and a molecular weight of 698.81 g/mol. Its IUPAC name is 4-[[4-[bis(4-carboxy-3,5-dimethylphenyl)methyl]phenyl]-(4-carboxy-3,5-dimethylphenyl)methyl]-2,6-dimethylbenzoic acid.
| Compound Name | 4-[[4-[bis(4-carboxy-3,5-dimethylphenyl)methyl]phenyl]-(4-carboxy-3,5-dimethylphenyl)methyl]-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 139962404 |
| Molecular Formula | C44H42O8 |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | 4-[[4-[bis(4-carboxy-3,5-dimethylphenyl)methyl]phenyl]-(4-carboxy-3,5-dimethylphenyl)methyl]-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C(c2ccc(C(c3cc(C)c(C(=O)O)c(C)c3)c3cc(C)c(C(=O)O)c(C)c3)cc2)c2cc(C)c(C(=O)O)c(C)c2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C44H42O8/c1-21-13-31(14-22(2)35(21)41(45)46)39(32-15-23(3)36(42(47)48)24(4)16-32)29-9-11-30(12-10-29)40(33-17-25(5)37(43(49)50)26(6)18-33)34-19-27(7)38(44(51)52)28(8)20-34/h9-20,39-40H,1-8H3,(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | VXPZQXDYNKKUEI-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|