C23H19NO8 — CID 70531085
5-[(3-carboxy-4-hydroxy-5-methylphenyl)-(4-nitrophenyl)methyl]-2-hydroxy-3-methylbenzoic acid (PubChem CID 70531085) has the molecular formula C23H19NO8 and a molecular weight of 437.40 g/mol. Its IUPAC name is 5-[(3-carboxy-4-hydroxy-5-methylphenyl)-(4-nitrophenyl)methyl]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[(3-carboxy-4-hydroxy-5-methylphenyl)-(4-nitrophenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 70531085 |
| Molecular Formula | C23H19NO8 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 5-[(3-carboxy-4-hydroxy-5-methylphenyl)-(4-nitrophenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(C(c2ccc([N+](=O)[O-])cc2)c2cc(C)c(O)c(C(=O)O)c2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C23H19NO8/c1-11-7-14(9-17(20(11)25)22(27)28)19(13-3-5-16(6-4-13)24(31)32)15-8-12(2)21(26)18(10-15)23(29)30/h3-10,19,25-26H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | OEDICUNPQDVBBT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|