C27H23NO10 — CID 70531614
2-acetyloxy-5-[(4-acetyloxy-3-carboxy-5-methylphenyl)-(4-nitrophenyl)methyl]-3-methylbenzoic acid (PubChem CID 70531614) has the molecular formula C27H23NO10 and a molecular weight of 521.48 g/mol. Its IUPAC name is 2-acetyloxy-5-[(4-acetyloxy-3-carboxy-5-methylphenyl)-(4-nitrophenyl)methyl]-3-methylbenzoic acid.
| Compound Name | 2-acetyloxy-5-[(4-acetyloxy-3-carboxy-5-methylphenyl)-(4-nitrophenyl)methyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 70531614 |
| Molecular Formula | C27H23NO10 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-acetyloxy-5-[(4-acetyloxy-3-carboxy-5-methylphenyl)-(4-nitrophenyl)methyl]-3-methylbenzoic acid |
| SMILES | CC(=O)Oc1c(C)cc(C(c2ccc([N+](=O)[O-])cc2)c2cc(C)c(OC(C)=O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C27H23NO10/c1-13-9-18(11-21(26(31)32)24(13)37-15(3)29)23(17-5-7-20(8-6-17)28(35)36)19-10-14(2)25(38-16(4)30)22(12-19)27(33)34/h5-12,23H,1-4H3,(H,31,32)(H,33,34) |
| InChIKey | VEUGOUSQLCIPHX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|