C9H8N2O6 — CID 10421833
[2-methyl-4,6-bis[oxido(oxo)(15N)(15N)azaniumyl]phenyl] acetate (PubChem CID 10421833) has the molecular formula C9H8N2O6 and a molecular weight of 242.16 g/mol. Its IUPAC name is [2-methyl-4,6-bis[oxido(oxo)(15N)(15N)azaniumyl]phenyl] acetate.
| Compound Name | [2-methyl-4,6-bis[oxido(oxo)(15N)(15N)azaniumyl]phenyl] acetate |
|---|---|
| PubChem CID | 10421833 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | [2-methyl-4,6-bis[oxido(oxo)(15N)(15N)azaniumyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc([15N+](=O)[O-])cc1[15N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O6/c1-5-3-7(10(13)14)4-8(11(15)16)9(5)17-6(2)12/h3-4H,1-2H3/i10+1,11+1 |
| InChIKey | OEMKFZGDLXBFNO-LCTSPGJJSA-N |
| XLogP | 1.74 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|