C15H30Cl2CoN14O6+3 — CID 173433720
cobalt(3+);tris(ethene-1,1,2,2-tetramine);(2-methyl-4,6-dinitrophenyl) 2,2-dichloroacetate (PubChem CID 173433720) has the molecular formula C15H30Cl2CoN14O6+3 and a molecular weight of 632.34 g/mol. Its IUPAC name is cobalt(3+);tris(ethene-1,1,2,2-tetramine);(2-methyl-4,6-dinitrophenyl) 2,2-dichloroacetate.
| Compound Name | cobalt(3+);tris(ethene-1,1,2,2-tetramine);(2-methyl-4,6-dinitrophenyl) 2,2-dichloroacetate |
|---|---|
| PubChem CID | 173433720 |
| Molecular Formula | C15H30Cl2CoN14O6+3 |
| Molecular Weight | 632.34 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | cobalt(3+);tris(ethene-1,1,2,2-tetramine);(2-methyl-4,6-dinitrophenyl) 2,2-dichloroacetate |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)C(Cl)Cl.NC(N)=C(N)N.NC(N)=C(N)N.NC(N)=C(N)N.[Co+3] |
| InChI | InChI=1S/C9H6Cl2N2O6.3C2H8N4.Co/c1-4-2-5(12(15)16)3-6(13(17)18)7(4)19-9(14)8(10)11;3*3-1(4)2(5)6;/h2-3,8H,1H3;3*3-6H2;/q;;;;+3 |
| InChIKey | RHXNTPUIQLHSET-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 424.82 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.34 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|