C8H5Cl2N3O5 — CID 2786287
1-(2-amino-3,5-dinitrophenyl)-2,2-dichloroethanone (PubChem CID 2786287) has the molecular formula C8H5Cl2N3O5 and a molecular weight of 294.05 g/mol. Its IUPAC name is 1-(2-amino-3,5-dinitrophenyl)-2,2-dichloroethanone.
| Compound Name | 1-(2-amino-3,5-dinitrophenyl)-2,2-dichloroethanone |
|---|---|
| PubChem CID | 2786287 |
| Molecular Formula | C8H5Cl2N3O5 |
| Molecular Weight | 294.05 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 1-(2-amino-3,5-dinitrophenyl)-2,2-dichloroethanone |
| SMILES | Nc1c(C(=O)C(Cl)Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5Cl2N3O5/c9-8(10)7(14)4-1-3(12(15)16)2-5(6(4)11)13(17)18/h1-2,8H,11H2 |
| InChIKey | VPTWBGHFQJKHRH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|