C10H9N7O7 — CID 71399704
pyridazine-3,5-diamine;2,4,6-trinitrophenol (PubChem CID 71399704) has the molecular formula C10H9N7O7 and a molecular weight of 339.22 g/mol. Its IUPAC name is pyridazine-3,5-diamine;2,4,6-trinitrophenol.
| Compound Name | pyridazine-3,5-diamine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71399704 |
| Molecular Formula | C10H9N7O7 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | pyridazine-3,5-diamine;2,4,6-trinitrophenol |
| SMILES | Nc1cnnc(N)c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C4H6N4/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;5-3-1-4(6)8-7-2-3/h1-2,10H;1-2H,(H4,5,6,8) |
| InChIKey | BUBLSYWKLASISU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 227.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|