C7H11N9O7 — CID 18779368
1,1,2-triaminoguanidine;2,4,6-trinitrophenol (PubChem CID 18779368) has the molecular formula C7H11N9O7 and a molecular weight of 333.22 g/mol. Its IUPAC name is 1,1,2-triaminoguanidine;2,4,6-trinitrophenol.
| Compound Name | 1,1,2-triaminoguanidine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 18779368 |
| Molecular Formula | C7H11N9O7 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1,1,2-triaminoguanidine;2,4,6-trinitrophenol |
| SMILES | N/N=C(\N)N(N)N.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.CH8N6/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;2-1(6-3)7(4)5/h1-2,10H;3-5H2,(H2,2,6) |
| InChIKey | WYQUSFHNALXJCF-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 269.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|