C14H21N7O7 — CID 54606997
1-N',2-N'-dipropylethanediimidamide;2,4,6-trinitrophenol (PubChem CID 54606997) has the molecular formula C14H21N7O7 and a molecular weight of 399.36 g/mol. Its IUPAC name is 1-N',2-N'-dipropylethanediimidamide;2,4,6-trinitrophenol.
| Compound Name | 1-N',2-N'-dipropylethanediimidamide;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 54606997 |
| Molecular Formula | C14H21N7O7 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-N',2-N'-dipropylethanediimidamide;2,4,6-trinitrophenol |
| SMILES | CCC/N=C(N)/C(N)=N/CCC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H18N4.C6H3N3O7/c1-3-5-11-7(9)8(10)12-6-4-2;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-6H2,1-2H3,(H2,9,11)(H2,10,12);1-2,10H |
| InChIKey | DXXQLJWYPPMNNA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 226.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|