C20H35N9O7 — CID 54604375
1-N',2-N'-bis[2-(butylamino)ethyl]ethanediimidamide;2,4,6-trinitrophenol (PubChem CID 54604375) has the molecular formula C20H35N9O7 and a molecular weight of 513.56 g/mol. Its IUPAC name is 1-N',2-N'-bis[2-(butylamino)ethyl]ethanediimidamide;2,4,6-trinitrophenol.
| Compound Name | 1-N',2-N'-bis[2-(butylamino)ethyl]ethanediimidamide;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 54604375 |
| Molecular Formula | C20H35N9O7 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 1-N',2-N'-bis[2-(butylamino)ethyl]ethanediimidamide;2,4,6-trinitrophenol |
| SMILES | CCCCNCC/N=C(N)/C(N)=N/CCNCCCC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H32N6.C6H3N3O7/c1-3-5-7-17-9-11-19-13(15)14(16)20-12-10-18-8-6-4-2;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h17-18H,3-12H2,1-2H3,(H2,15,19)(H2,16,20);1-2,10H |
| InChIKey | MRDSKHDDPIPHSQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 250.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|