C12H15N5O8 — CID 90458838
(2,4,6-trinitrophenyl) (2S)-2,6-diaminohexanoate (PubChem CID 90458838) has the molecular formula C12H15N5O8 and a molecular weight of 357.28 g/mol. Its IUPAC name is (2,4,6-trinitrophenyl) (2S)-2,6-diaminohexanoate.
| Compound Name | (2,4,6-trinitrophenyl) (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 90458838 |
| Molecular Formula | C12H15N5O8 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2,4,6-trinitrophenyl) (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N5O8/c13-4-2-1-3-8(14)12(18)25-11-9(16(21)22)5-7(15(19)20)6-10(11)17(23)24/h5-6,8H,1-4,13-14H2/t8-/m0/s1 |
| InChIKey | FFLYPNPNHGCGAP-QMMMGPOBSA-N |
| XLogP | 0.77 |
| TPSA | 207.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|