(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid

C15H20N2O6S — CID 88745084

IUPAC(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid
SMILESCCCCCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)S
InChIInChI=1S/C15H20N2O6S/c1-3-4-5-6-7-10(2)12-8-11(16(19)20)9-13(17(21)22)14(12)23-15(18)24/h8-10H,3-7H2,1-2H3,(H,18,24)
InChIKeyWPFNCZLSEXAHJT-UHFFFAOYSA-N
MW356.40 g/mol
LogP5.01
Rot. Bonds9

About (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid

(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid (PubChem CID 88745084) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid.

Molecular Properties

Compound Name(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid
PubChem CID88745084
Molecular FormulaC15H20N2O6S
Molecular Weight356.40 g/mol
Exact Mass356.10
IUPAC Name(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid
SMILESCCCCCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)S
InChIInChI=1S/C15H20N2O6S/c1-3-4-5-6-7-10(2)12-8-11(16(19)20)9-13(17(21)22)14(12)23-15(18)24/h8-10H,3-7H2,1-2H3,(H,18,24)
InChIKeyWPFNCZLSEXAHJT-UHFFFAOYSA-N
XLogP5.01
TPSA112.58 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.40
LogP ≤ 55.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid?
The IUPAC name of (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid (CID 88745084) is (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid.
What is the SMILES notation for (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid?
The canonical SMILES for (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid is CCCCCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)S.
What is the InChIKey of (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid?
The InChIKey is WPFNCZLSEXAHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O6S/c1-3-4-5-6-7-10(2)12-8-11(16(19)20)9-13(17(21)22)14(12)23-15(18)24/h8-10H,3-7H2,1-2H3,(H,18,24).
What are the key properties of (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid?
(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid has a molecular weight of 356.40 g/mol, XLogP of 5.01, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid is sourced from PubChem (CID 88745084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).