C15H20N2O6S — CID 88745084
(2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid (PubChem CID 88745084) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid.
| Compound Name | (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid |
|---|---|
| PubChem CID | 88745084 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2,4-dinitro-6-octan-2-ylphenoxy)methanethioic S-acid |
| SMILES | CCCCCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)S |
| InChI | InChI=1S/C15H20N2O6S/c1-3-4-5-6-7-10(2)12-8-11(16(19)20)9-13(17(21)22)14(12)23-15(18)24/h8-10H,3-7H2,1-2H3,(H,18,24) |
| InChIKey | WPFNCZLSEXAHJT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|