About (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate
(2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate (PubChem CID 22954278) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate.
Molecular Properties
| Compound Name | (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate |
| PubChem CID | 22954278 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)Oc1c(C)cc([N+](=O)[O-])cc1C(C)CCCCCC |
| InChI | InChI=1S/C19H27NO4/c1-5-7-8-9-11-14(3)17-13-16(20(22)23)12-15(4)19(17)24-18(21)10-6-2/h6,10,12-14H,5,7-9,11H2,1-4H3/b10-6+ |
| InChIKey | FJBRLUFJPKNDCF-UXBLZVDNSA-N |
| XLogP | 5.46 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate?
The IUPAC name of (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate (CID 22954278) is (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate.
What is the SMILES notation for (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate?
The canonical SMILES for (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate is C/C=C/C(=O)Oc1c(C)cc([N+](=O)[O-])cc1C(C)CCCCCC.
What is the InChIKey of (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate?
The InChIKey is FJBRLUFJPKNDCF-UXBLZVDNSA-N. The full InChI is InChI=1S/C19H27NO4/c1-5-7-8-9-11-14(3)17-13-16(20(22)23)12-15(4)19(17)24-18(21)10-6-2/h6,10,12-14H,5,7-9,11H2,1-4H3/b10-6+.
What are the key properties of (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate?
(2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate has a molecular weight of 333.43 g/mol, XLogP of 5.46, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-nitro-6-octan-2-ylphenyl) (E)-but-2-enoate is sourced from PubChem (CID 22954278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).