C18H24N2O6 — CID 24718
[4-(2,5-dimethylhexan-2-yl)-2,6-dinitrophenyl] but-2-enoate (PubChem CID 24718) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [4-(2,5-dimethylhexan-2-yl)-2,6-dinitrophenyl] but-2-enoate.
| Compound Name | [4-(2,5-dimethylhexan-2-yl)-2,6-dinitrophenyl] but-2-enoate |
|---|---|
| PubChem CID | 24718 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [4-(2,5-dimethylhexan-2-yl)-2,6-dinitrophenyl] but-2-enoate |
| SMILES | CC=CC(=O)Oc1c([N+](=O)[O-])cc(C(C)(C)CCC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O6/c1-6-7-16(21)26-17-14(19(22)23)10-13(11-15(17)20(24)25)18(4,5)9-8-12(2)3/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | WHZYVMOARRCVLT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|