C17H22N2O6 — CID 142689518
(4-heptan-2-yl-2,6-dinitrophenyl) (E)-but-2-enoate (PubChem CID 142689518) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (4-heptan-2-yl-2,6-dinitrophenyl) (E)-but-2-enoate.
| Compound Name | (4-heptan-2-yl-2,6-dinitrophenyl) (E)-but-2-enoate |
|---|---|
| PubChem CID | 142689518 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4-heptan-2-yl-2,6-dinitrophenyl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)Oc1c([N+](=O)[O-])cc(C(C)CCCCC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N2O6/c1-4-6-7-9-12(3)13-10-14(18(21)22)17(15(11-13)19(23)24)25-16(20)8-5-2/h5,8,10-12H,4,6-7,9H2,1-3H3/b8-5+ |
| InChIKey | IPSKTGYJUZHFSF-VMPITWQZSA-N |
| XLogP | 4.67 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|