C15H24O2 — CID 15347172
5-nonan-2-ylbenzene-1,3-diol (PubChem CID 15347172) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 5-nonan-2-ylbenzene-1,3-diol.
| Compound Name | 5-nonan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 15347172 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 5-nonan-2-ylbenzene-1,3-diol |
| SMILES | CCCCCCCC(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H24O2/c1-3-4-5-6-7-8-12(2)13-9-14(16)11-15(17)10-13/h9-12,16-17H,3-8H2,1-2H3 |
| InChIKey | RQMACUQCZAZPSP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|