C11H15BrO2 — CID 54428742
5-(1-bromopentyl)benzene-1,3-diol (PubChem CID 54428742) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 5-(1-bromopentyl)benzene-1,3-diol.
| Compound Name | 5-(1-bromopentyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 54428742 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-(1-bromopentyl)benzene-1,3-diol |
| SMILES | CCCCC(Br)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H15BrO2/c1-2-3-4-11(12)8-5-9(13)7-10(14)6-8/h5-7,11,13-14H,2-4H2,1H3 |
| InChIKey | WFZLFEWIUBEBFQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|