C13H17BrO2 — CID 61096500
6-(1-bromopentyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 61096500) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 6-(1-bromopentyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-bromopentyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 61096500 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6-(1-bromopentyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCCCC(Br)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H17BrO2/c1-2-3-4-11(14)10-5-6-12-13(9-10)16-8-7-15-12/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | YBVRRGZFZYJTGX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|