C38H60O8 — CID 98159723
(1S)-1-[24-[(1S)-1-hydroxynonyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]nonan-1-ol (PubChem CID 98159723) has the molecular formula C38H60O8 and a molecular weight of 644.89 g/mol. Its IUPAC name is (1S)-1-[24-[(1S)-1-hydroxynonyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]nonan-1-ol.
| Compound Name | (1S)-1-[24-[(1S)-1-hydroxynonyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]nonan-1-ol |
|---|---|
| PubChem CID | 98159723 |
| Molecular Formula | C38H60O8 |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | (1S)-1-[24-[(1S)-1-hydroxynonyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]nonan-1-ol |
| SMILES | CCCCCCCC[C@H](O)c1ccc2c(c1)OCCOCCOc1ccc([C@@H](O)CCCCCCCC)cc1OCCOCCO2 |
| InChI | InChI=1S/C38H60O8/c1-3-5-7-9-11-13-15-33(39)31-17-19-35-37(29-31)45-27-23-41-22-26-44-36-20-18-32(34(40)16-14-12-10-8-6-4-2)30-38(36)46-28-24-42-21-25-43-35/h17-20,29-30,33-34,39-40H,3-16,21-28H2,1-2H3/t33-,34-/m0/s1 |
| InChIKey | LRQDDDXIBBXZBZ-HEVIKAOCSA-N |
| XLogP | 8.52 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|