C14H20O2 — CID 61099251
1-(2,3-dihydro-1-benzofuran-5-yl)hexan-1-ol (PubChem CID 61099251) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)hexan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)hexan-1-ol |
|---|---|
| PubChem CID | 61099251 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)hexan-1-ol |
| SMILES | CCCCCC(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H20O2/c1-2-3-4-5-13(15)11-6-7-14-12(10-11)8-9-16-14/h6-7,10,13,15H,2-5,8-9H2,1H3 |
| InChIKey | HEUFDAAINSQLKM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|