C13H18O3 — CID 79567818
1-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxyethanol (PubChem CID 79567818) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxyethanol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxyethanol |
|---|---|
| PubChem CID | 79567818 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxyethanol |
| SMILES | CC(C)OCC(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H18O3/c1-9(2)16-8-12(14)10-3-4-13-11(7-10)5-6-15-13/h3-4,7,9,12,14H,5-6,8H2,1-2H3 |
| InChIKey | UVEGGNKLHLLYFQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |