C19H28O2 — CID 63426478
(4-tert-butylcyclohexyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol (PubChem CID 63426478) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol.
| Compound Name | (4-tert-butylcyclohexyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol |
|---|---|
| PubChem CID | 63426478 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (4-tert-butylcyclohexyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol |
| SMILES | CC(C)(C)C1CCC(C(O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C19H28O2/c1-19(2,3)16-7-4-13(5-8-16)18(20)15-6-9-17-14(12-15)10-11-21-17/h6,9,12-13,16,18,20H,4-5,7-8,10-11H2,1-3H3 |
| InChIKey | LQBXALPDEYFNOZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |