C12H14O3 — CID 61086940
cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methanol (PubChem CID 61086940) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methanol.
| Compound Name | cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methanol |
|---|---|
| PubChem CID | 61086940 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methanol |
| SMILES | OC(c1ccc2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C12H14O3/c13-12(8-1-2-8)9-3-4-10-11(7-9)15-6-5-14-10/h3-4,7-8,12-13H,1-2,5-6H2 |
| InChIKey | BOENTZYYJMIBCQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |