C13H16O5 — CID 55120197
2,3-dihydro-1,4-benzodioxin-6-yl(1,4-dioxan-2-yl)methanol (PubChem CID 55120197) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl(1,4-dioxan-2-yl)methanol.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 55120197 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl(1,4-dioxan-2-yl)methanol |
| SMILES | OC(c1ccc2c(c1)OCCO2)C1COCCO1 |
| InChI | InChI=1S/C13H16O5/c14-13(12-8-15-3-4-18-12)9-1-2-10-11(7-9)17-6-5-16-10/h1-2,7,12-14H,3-6,8H2 |
| InChIKey | XOSATWIEJQYIGH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |