C13H16O4 — CID 63935647
1,3-benzodioxol-5-yl(oxan-4-yl)methanol (PubChem CID 63935647) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(oxan-4-yl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl(oxan-4-yl)methanol |
|---|---|
| PubChem CID | 63935647 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl(oxan-4-yl)methanol |
| SMILES | OC(c1ccc2c(c1)OCO2)C1CCOCC1 |
| InChI | InChI=1S/C13H16O4/c14-13(9-3-5-15-6-4-9)10-1-2-11-12(7-10)17-8-16-11/h1-2,7,9,13-14H,3-6,8H2 |
| InChIKey | UJQIIWINZZLYKC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |