C14H17BrO3 — CID 62906750
6-[bromo(oxan-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 62906750) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-[bromo(oxan-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[bromo(oxan-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 62906750 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 6-[bromo(oxan-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrC(c1ccc2c(c1)OCCO2)C1CCOCC1 |
| InChI | InChI=1S/C14H17BrO3/c15-14(10-3-5-16-6-4-10)11-1-2-12-13(9-11)18-8-7-17-12/h1-2,9-10,14H,3-8H2 |
| InChIKey | HWTZTIVHBGWOHT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|