C17H26Cl2N2O3 — CID 171297107
1-[(R)-1,3-benzodioxol-5-yl(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171297107) has the molecular formula C17H26Cl2N2O3 and a molecular weight of 377.31 g/mol. Its IUPAC name is 1-[(R)-1,3-benzodioxol-5-yl(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-1,3-benzodioxol-5-yl(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171297107 |
| Molecular Formula | C17H26Cl2N2O3 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[(R)-1,3-benzodioxol-5-yl(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1cc2c(cc1[C@@H](C1CCOCC1)N1CCNCC1)OCO2 |
| InChI | InChI=1S/C17H24N2O3.2ClH/c1-2-15-16(22-12-21-15)11-14(1)17(13-3-9-20-10-4-13)19-7-5-18-6-8-19;;/h1-2,11,13,17-18H,3-10,12H2;2*1H/t17-;;/m1../s1 |
| InChIKey | KDUIOQOSBOQRET-ZEECNFPPSA-N |
| XLogP | 2.63 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |