C16H22N2O2 — CID 171297111
1-[(1R)-1-(1,3-benzodioxol-5-yl)-2-cyclopropylethyl]piperazine (PubChem CID 171297111) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzodioxol-5-yl)-2-cyclopropylethyl]piperazine.
| Compound Name | 1-[(1R)-1-(1,3-benzodioxol-5-yl)-2-cyclopropylethyl]piperazine |
|---|---|
| PubChem CID | 171297111 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzodioxol-5-yl)-2-cyclopropylethyl]piperazine |
| SMILES | c1cc2c(cc1[C@@H](CC1CC1)N1CCNCC1)OCO2 |
| InChI | InChI=1S/C16H22N2O2/c1-2-12(1)9-14(18-7-5-17-6-8-18)13-3-4-15-16(10-13)20-11-19-15/h3-4,10,12,14,17H,1-2,5-9,11H2/t14-/m1/s1 |
| InChIKey | GFMQECAWVQPVKG-CQSZACIVSA-N |
| XLogP | 2.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |