C16H26Cl2N2O2 — CID 171284492
1-[(1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutyl]piperazine;dihydrochloride (PubChem CID 171284492) has the molecular formula C16H26Cl2N2O2 and a molecular weight of 349.30 g/mol. Its IUPAC name is 1-[(1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284492 |
| Molecular Formula | C16H26Cl2N2O2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutyl]piperazine;dihydrochloride |
| SMILES | CC(C)C[C@@H](c1ccc2c(c1)OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O2.2ClH/c1-12(2)9-14(18-7-5-17-6-8-18)13-3-4-15-16(10-13)20-11-19-15;;/h3-4,10,12,14,17H,5-9,11H2,1-2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | ARNGARNBHFOYJD-UTLKBRERSA-N |
| XLogP | 3.25 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |