C19H27BrO — CID 63438093
5-[bromo-(4-tert-butylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 63438093) has the molecular formula C19H27BrO and a molecular weight of 351.33 g/mol. Its IUPAC name is 5-[bromo-(4-tert-butylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[bromo-(4-tert-butylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63438093 |
| Molecular Formula | C19H27BrO |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-[bromo-(4-tert-butylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)(C)C1CCC(C(Br)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C19H27BrO/c1-19(2,3)16-7-4-13(5-8-16)18(20)15-6-9-17-14(12-15)10-11-21-17/h6,9,12-13,16,18H,4-5,7-8,10-11H2,1-3H3 |
| InChIKey | NODCOIYSEWNKKK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|