C18H28N2O — CID 105232601
[2,3-dihydro-1-benzofuran-5-yl-(4-propan-2-ylcyclohexyl)methyl]hydrazine (PubChem CID 105232601) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is [2,3-dihydro-1-benzofuran-5-yl-(4-propan-2-ylcyclohexyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1-benzofuran-5-yl-(4-propan-2-ylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105232601 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | [2,3-dihydro-1-benzofuran-5-yl-(4-propan-2-ylcyclohexyl)methyl]hydrazine |
| SMILES | CC(C)C1CCC(C(NN)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-12(2)13-3-5-14(6-4-13)18(20-19)16-7-8-17-15(11-16)9-10-21-17/h7-8,11-14,18,20H,3-6,9-10,19H2,1-2H3 |
| InChIKey | RZFWHYWDKHXDDG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|