C14H19BrO2 — CID 55199144
6-(1-bromohexyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 55199144) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 6-(1-bromohexyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-bromohexyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 55199144 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-(1-bromohexyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCCCCC(Br)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H19BrO2/c1-2-3-4-5-12(15)11-6-7-13-14(10-11)17-9-8-16-13/h6-7,10,12H,2-5,8-9H2,1H3 |
| InChIKey | CNNFTFCECCVWBL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|