C17H24BrNO2 — CID 104526666
7-(1-bromooctyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104526666) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 7-(1-bromooctyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-(1-bromooctyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104526666 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 7-(1-bromooctyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | CCCCCCCC(Br)c1ccc2c(c1)C(=O)NCCO2 |
| InChI | InChI=1S/C17H24BrNO2/c1-2-3-4-5-6-7-15(18)13-8-9-16-14(12-13)17(20)19-10-11-21-16/h8-9,12,15H,2-7,10-11H2,1H3,(H,19,20) |
| InChIKey | HURHELXOVZAVBB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|