About 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one
7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104525497) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| PubChem CID | 104525497 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | CCCCC(CC)C(=O)c1ccc2c(c1)C(=O)NCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-3-5-6-12(4-2)16(19)13-7-8-15-14(11-13)17(20)18-9-10-21-15/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | WQEHBWKWUNJDGH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The IUPAC name of 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CID 104525497) is 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The canonical SMILES for 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one is CCCCC(CC)C(=O)c1ccc2c(c1)C(=O)NCCO2.
What is the InChIKey of 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The InChIKey is WQEHBWKWUNJDGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-3-5-6-12(4-2)16(19)13-7-8-15-14(11-13)17(20)18-9-10-21-15/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,18,20).
What are the key properties of 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one has a molecular weight of 289.38 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-ethylhexanoyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 104525497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).