C11H9BrF3NO2 — CID 104526692
7-(1-bromo-2,2,2-trifluoroethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104526692) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is 7-(1-bromo-2,2,2-trifluoroethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-(1-bromo-2,2,2-trifluoroethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104526692 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 7-(1-bromo-2,2,2-trifluoroethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2ccc(C(Br)C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H9BrF3NO2/c12-9(11(13,14)15)6-1-2-8-7(5-6)10(17)16-3-4-18-8/h1-2,5,9H,3-4H2,(H,16,17) |
| InChIKey | XHQFHSVOXMIHNJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|