About 3-octan-4-ylphenol
3-octan-4-ylphenol (PubChem CID 54137408) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-octan-4-ylphenol.
Molecular Properties
| Compound Name | 3-octan-4-ylphenol |
| PubChem CID | 54137408 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 3-octan-4-ylphenol |
| SMILES | CCCCC(CCC)c1cccc(O)c1 |
| InChI | InChI=1S/C14H22O/c1-3-5-8-12(7-4-2)13-9-6-10-14(15)11-13/h6,9-12,15H,3-5,7-8H2,1-2H3 |
| InChIKey | CKOOWBPAJBNFRZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-octan-4-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octan-4-ylphenol?
The IUPAC name of 3-octan-4-ylphenol (CID 54137408) is 3-octan-4-ylphenol.
What is the SMILES notation for 3-octan-4-ylphenol?
The canonical SMILES for 3-octan-4-ylphenol is CCCCC(CCC)c1cccc(O)c1.
What is the InChIKey of 3-octan-4-ylphenol?
The InChIKey is CKOOWBPAJBNFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-3-5-8-12(7-4-2)13-9-6-10-14(15)11-13/h6,9-12,15H,3-5,7-8H2,1-2H3.
What are the key properties of 3-octan-4-ylphenol?
3-octan-4-ylphenol has a molecular weight of 206.33 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octan-4-ylphenol is sourced from PubChem (CID 54137408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).