About 3-(dibutoxymethyl)phenol
3-(dibutoxymethyl)phenol (PubChem CID 71333002) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 3-(dibutoxymethyl)phenol.
Molecular Properties
| Compound Name | 3-(dibutoxymethyl)phenol |
| PubChem CID | 71333002 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-(dibutoxymethyl)phenol |
| SMILES | CCCCOC(OCCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C15H24O3/c1-3-5-10-17-15(18-11-6-4-2)13-8-7-9-14(16)12-13/h7-9,12,15-16H,3-6,10-11H2,1-2H3 |
| InChIKey | IUXZUNCWAUKLDT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibutoxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutoxymethyl)phenol?
The IUPAC name of 3-(dibutoxymethyl)phenol (CID 71333002) is 3-(dibutoxymethyl)phenol.
What is the SMILES notation for 3-(dibutoxymethyl)phenol?
The canonical SMILES for 3-(dibutoxymethyl)phenol is CCCCOC(OCCCC)c1cccc(O)c1.
What is the InChIKey of 3-(dibutoxymethyl)phenol?
The InChIKey is IUXZUNCWAUKLDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-5-10-17-15(18-11-6-4-2)13-8-7-9-14(16)12-13/h7-9,12,15-16H,3-6,10-11H2,1-2H3.
What are the key properties of 3-(dibutoxymethyl)phenol?
3-(dibutoxymethyl)phenol has a molecular weight of 252.35 g/mol, XLogP of 4.02, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutoxymethyl)phenol is sourced from PubChem (CID 71333002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).