C18H22O2 — CID 6917687
3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol (PubChem CID 6917687) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol.
| Compound Name | 3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol |
|---|---|
| PubChem CID | 6917687 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol |
| SMILES | CC[C@H](c1cccc(O)c1)[C@@H](CC)c1cccc(O)c1 |
| InChI | InChI=1S/C18H22O2/c1-3-17(13-7-5-9-15(19)11-13)18(4-2)14-8-6-10-16(20)12-14/h5-12,17-20H,3-4H2,1-2H3/t17-,18+ |
| InChIKey | KUJAWCSIKNKXLL-HDICACEKSA-N |
| XLogP | 4.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |