C26H31NO — CID 118204770
3-[(2R,3R)-1-(dibenzylamino)-2-methylpentan-3-yl]phenol (PubChem CID 118204770) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is 3-[(2R,3R)-1-(dibenzylamino)-2-methylpentan-3-yl]phenol.
| Compound Name | 3-[(2R,3R)-1-(dibenzylamino)-2-methylpentan-3-yl]phenol |
|---|---|
| PubChem CID | 118204770 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 3-[(2R,3R)-1-(dibenzylamino)-2-methylpentan-3-yl]phenol |
| SMILES | CC[C@@H](c1cccc(O)c1)[C@@H](C)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO/c1-3-26(24-15-10-16-25(28)17-24)21(2)18-27(19-22-11-6-4-7-12-22)20-23-13-8-5-9-14-23/h4-17,21,26,28H,3,18-20H2,1-2H3/t21-,26+/m0/s1 |
| InChIKey | DQUZKSVVNATTCK-HFZDXXHNSA-N |
| XLogP | 6.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |