C18H29NO6 — CID 90279936
(Z)-but-2-enedioic acid;3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrate (PubChem CID 90279936) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrate |
|---|---|
| PubChem CID | 90279936 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrate |
| SMILES | CC[C@@H](c1cccc(O)c1)[C@@H](C)CN(C)C.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H23NO.C4H4O4.H2O/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12;5-3(6)1-2-4(7)8;/h6-9,11,14,16H,5,10H2,1-4H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1-;/t11-,14+;;/m0../s1 |
| InChIKey | BHFVETAAULCQOU-BAQCANMLSA-N |
| XLogP | 1.97 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|